3-(Difluoromethyl)-4,5-difluoropyridin-2-ol
Modify Date: 2025-09-10 13:40:46
3-(Difluoromethyl)-4,5-difluoropyridin-2-ol structure
|
Common Name | 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1806009-23-3 | Molecular Weight | 181.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3F4NO |
|---|---|
| Molecular Weight | 181.09 |
| InChIKey | CUWAQWNJDDMWJK-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cc(F)c(F)c1C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol? |
| A: InChIKey of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol is CUWAQWNJDDMWJK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol? |
| A: Molecular weight of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol is 181.09. |
| Q: What is the SMILES notation of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol? |
| A: SMILES notation of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol is O=c1[nH]cc(F)c(F)c1C(F)F. |
| Q: What is the CAS number of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol? |
| A: CAS number of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol is 1806009-23-3. |
| Q: What is the English name of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol? |
| A: The English name of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol is 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol. |
| Q: What is the Chinese name of 1806009-23-3? |
| A: Chinese name of 1806009-23-3 is 1806009-23-3. |
| Q: What is the molecular formula of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol? |
| A: Molecular formula of 3-(Difluoromethyl)-4,5-difluoropyridin-2-ol is C6H3F4NO. |