AL-8417
Modify Date: 2025-09-19 15:20:43
AL-8417 structure
|
Common Name | AL-8417 | ||
|---|---|---|---|---|
| CAS Number | 180472-20-2 | Molecular Weight | 462.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AL-8417AL-8417 is an enzyme inhibitor. It acting as an antioxidant, anti-inflammatory, and cytostatic agent. It also has the ability to suppress vitrectomy-induced posterior lens fiber changes. |
| Name | AL-8417 |
|---|
| Description | AL-8417 is an enzyme inhibitor. It acting as an antioxidant, anti-inflammatory, and cytostatic agent. It also has the ability to suppress vitrectomy-induced posterior lens fiber changes. |
|---|---|
| References | 1. David KC, Brady MT, Weimer LK, Hellberg MR, Nixon JC, Graff G. Characterization of the in vitro anti-inflammatory activity of AL-5898 and related benzopyranyl esters and amides. Inflammation. 2003 Feb;27(1):31-43. PubMed PMID: 12772775. |
| Molecular Formula | C29H34O5 |
|---|---|
| Molecular Weight | 462.58 |
| InChIKey | KYECYAFVFZRXIM-ADXZGYQBSA-N |
| SMILES | COc1ccc2cc(C(C)C(=O)OCCC3(C)CCc4c(C)c(O)c(C)c(C)c4O3)ccc2c1 |