N-[ditert-butyl(methylamino)silyl]methanamine structure
|
Common Name | N-[ditert-butyl(methylamino)silyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 180332-62-1 | Molecular Weight | 202.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H26N2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[ditert-butyl(methylamino)silyl]methanamine |
|---|
| Molecular Formula | C10H26N2Si |
|---|---|
| Molecular Weight | 202.41200 |
| Exact Mass | 202.18700 |
| PSA | 24.06000 |
| LogP | 3.24940 |
| InChIKey | JUUUXMQFQCQITF-UHFFFAOYSA-N |
| SMILES | CN[Si](NC)(C(C)(C)C)C(C)(C)C |
|
~89%
N-[ditert-butyl... CAS#:180332-62-1 |
| Literature: Toho Catalyst Co., Ltd. Patent: EP1908767 A1, 2008 ; Location in patent: Page/Page column 27-28 ; |
|
~87%
N-[ditert-butyl... CAS#:180332-62-1 |
| Literature: Herbst-Irmer, Regine; Klingebiel, Uwe; Noltemeyer, Mathias; Rakebrandt, Hans-Joerg; Rudolph, Stefanie Phosphorus, Sulfur and Silicon and Related Elements, 1996 , vol. 112, # 1-4 p. 185 - 192 |