1-[3-(3-acetylsulfanylpropyl-dimethyl-silyl)propylsulfanyl]ethanone structure
|
Common Name | 1-[3-(3-acetylsulfanylpropyl-dimethyl-silyl)propylsulfanyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 18027-92-4 | Molecular Weight | 292.53300 | |
| Density | 1.028g/cm3 | Boiling Point | 349.2ºC at 760 mmHg | |
| Molecular Formula | C12H24O2S2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | S-[3-[3-acetylsulfanylpropyl(dimethyl)silyl]propyl] ethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.028g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760 mmHg |
| Molecular Formula | C12H24O2S2Si |
| Molecular Weight | 292.53300 |
| Flash Point | 165ºC |
| Exact Mass | 292.09900 |
| PSA | 84.74000 |
| LogP | 4.03440 |
| Vapour Pressure | 4.79E-05mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | GZVZFFDYEUECJP-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCC[Si](C)(C)CCCSC(C)=O |
|
~80%
1-[3-(3-acetyls... CAS#:18027-92-4 |
| Literature: Gmelin Handbook: Si: MVol.C, 10, page 32 - 34 |
|
~%
1-[3-(3-acetyls... CAS#:18027-92-4 |
| Literature: Marvel; Cripps Journal of Polymer Science, 1952 , vol. 9, p. 53,57 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[3-(3-acetylsulfanylpropyl-dimethyl-silyl)propylsulfanyl]ethanone |
| me2Si(pr-3-Sac)2 |
| Bis-(3-acetylmercapto-propyl)-dimethyl-silan |
| bis-(3-acetylsulfanyl-propyl)-dimethyl-silane |