Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate
Modify Date: 2025-08-21 14:31:07
Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate structure
|
Common Name | Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1800260-53-0 | Molecular Weight | 251.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14FNO3 |
|---|---|
| Molecular Weight | 251.25 |
| InChIKey | FPXFQDORBLEHIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=O)Cc2ccc(F)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate? |
| A: Molecular formula of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate is C13H14FNO3. |
| Q: What is the English name of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate? |
| A: The English name of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate is Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate. |
| Q: What is the SMILES notation of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate? |
| A: SMILES notation of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate is CC(C)(C)OC(=O)N1C(=O)Cc2ccc(F)cc21. |
| Q: What is the InChIKey of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate? |
| A: InChIKey of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate is FPXFQDORBLEHIQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate? |
| A: Molecular weight of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate is 251.25. |
| Q: What is the Chinese name of 1800260-53-0? |
| A: Chinese name of 1800260-53-0 is 1800260-53-0. |
| Q: What is the CAS number of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate? |
| A: CAS number of Tert-butyl 6-fluoro-2-oxoindoline-1-carboxylate is 1800260-53-0. |