KI696 isomer structure
|
Common Name | KI696 isomer | ||
|---|---|---|---|---|
| CAS Number | 1799974-69-8 | Molecular Weight | 550.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H30N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KI696 isomerKI696 isomer is the less active isomer of KI696. KI696 is a high affinity probe that disrupts the Keap1/NRF2 interaction. |
| Name | KI696 isomer |
|---|
| Description | KI696 isomer is the less active isomer of KI696. KI696 is a high affinity probe that disrupts the Keap1/NRF2 interaction. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H30N4O6S |
|---|---|
| Molecular Weight | 550.63 |
| InChIKey | ZDNGJXBUEQNFBQ-XMSQKQJNSA-N |
| SMILES | COc1cc(C(CC(=O)O)c2ccc(C)c(CN3CC(C)Oc4ccccc4S3(=O)=O)c2)cc2nnn(C)c12 |
| Storage condition | 2-8℃ |