2-Pyridineacrylonitrile,a-(p-chlorophenyl)-(8CI) structure
|
Common Name | 2-Pyridineacrylonitrile,a-(p-chlorophenyl)-(8CI) | ||
|---|---|---|---|---|
| CAS Number | 17999-67-6 | Molecular Weight | 240.68800 | |
| Density | 1.259g/cm3 | Boiling Point | 382.2ºC at 760mmHg | |
| Molecular Formula | C14H9ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | 2-(4-chlorophenyl)-3-pyridin-2-ylprop-2-enenitrile |
|---|
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 382.2ºC at 760mmHg |
| Molecular Formula | C14H9ClN2 |
| Molecular Weight | 240.68800 |
| Flash Point | 184.9ºC |
| Exact Mass | 240.04500 |
| PSA | 36.68000 |
| LogP | 3.79918 |
| Vapour Pressure | 4.81E-06mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | FSCJSMAWFIFUNF-FMIVXFBMSA-N |
| SMILES | N#CC(=Cc1ccccn1)c1ccc(Cl)cc1 |
|
~%
2-Pyridineacryl... CAS#:17999-67-6 |
| Literature: Buu-Hoi et al. Journal of Organic Chemistry, 1955 , vol. 20, p. 1407,1410 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |