A812511 structure
|
Common Name | A812511 | ||
|---|---|---|---|---|
| CAS Number | 179985-52-5 | Molecular Weight | 225.25 | |
| Density | 1.24g/cm3 | Boiling Point | 489.7ºC at 760 mmHg | |
| Molecular Formula | C13H11N3O | Melting Point | 200-202ºC | |
| MSDS | N/A | Flash Point | 250ºC | |
Use of A812511PKA-IN-1 is a potent and selective cyclic AMP-dependent protein kinase (PKA) catalytic subunit (cAK) inhibitor with an IC50 of 0.03 μM[1]. |
| Name | N-(4-cyano-3-methylisoquinolin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | PKA-IN-1 is a potent and selective cyclic AMP-dependent protein kinase (PKA) catalytic subunit (cAK) inhibitor with an IC50 of 0.03 μM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.03 μM (cAK)[1] |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 489.7ºC at 760 mmHg |
| Melting Point | 200-202ºC |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 |
| Flash Point | 250ºC |
| Exact Mass | 225.09000 |
| PSA | 65.78000 |
| LogP | 2.44628 |
| Vapour Pressure | 9.74E-10mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | SRNACQXBALMDDC-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1nc(C)c(C#N)c2ccccc12 |
| 1-ACETAMIDO-4-CYANO-3-METHYLISOQUINOLINE |
| 1-Acetamido-3-methyl-4-cyanosoquinoline |