(1-(tert-Butoxycarbonyl)-2,2,4-triMethyl-1,2-dihydroquinolin-6-yl)boronic acid
Modify Date: 2025-07-25 13:30:35
(1-(tert-Butoxycarbonyl)-2,2,4-triMethyl-1,2-dihydroquinolin-6-yl)boronic acid structure
|
Common Name | (1-(tert-Butoxycarbonyl)-2,2,4-triMethyl-1,2-dihydroquinolin-6-yl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 179894-36-1 | Molecular Weight | 317.18800 | |
| Density | 1.17g/cm3 | Boiling Point | 464.626ºC at 760 mmHg | |
| Molecular Formula | C17H24BNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.798ºC | |
| Name | [2,2,4-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]quinolin-6-yl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 464.626ºC at 760 mmHg |
| Molecular Formula | C17H24BNO4 |
| Molecular Weight | 317.18800 |
| Flash Point | 234.798ºC |
| Exact Mass | 317.18000 |
| PSA | 70.00000 |
| LogP | 2.36840 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | GRFGSJUDWQWNGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)N(C(=O)OC(C)(C)C)c2ccc(B(O)O)cc21 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| i04-1404 |
| (2,2,4-Trimethyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-1,2-dihydro-6-quinolinyl)boronic acid |
| [1-(tert-butoxycarbonyl)-2,2,4-trimethyl-1,2-dihydroquinolin-6-yl]boronic acid |
| 1(2H)-Quinolinecarboxylic acid, 6-borono-2,2,4-trimethyl-, 1,1-dimethylethyl ester |
| MFCD13248580 |
| (1-(tert-Butoxycarbonyl)-2,2,4-triMethyl-1,2-dihydroquinolin-6-yl)boronic acid |