Ethylamine, N,N-bis(trimethylsilyl)methyl]- structure
|
Common Name | Ethylamine, N,N-bis(trimethylsilyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 17988-70-4 | Molecular Weight | 217.49900 | |
| Density | 0.798g/cm3 | Boiling Point | 177.5ºC at 760mmHg | |
| Molecular Formula | C10H27NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 61.2ºC | |
| Name | N,N-bis(trimethylsilylmethyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.798g/cm3 |
|---|---|
| Boiling Point | 177.5ºC at 760mmHg |
| Molecular Formula | C10H27NSi2 |
| Molecular Weight | 217.49900 |
| Flash Point | 61.2ºC |
| Exact Mass | 217.16800 |
| PSA | 3.24000 |
| LogP | 3.89970 |
| Vapour Pressure | 1.04mmHg at 25°C |
| Index of Refraction | 1.424 |
| InChIKey | AOPUIYWQICJKPO-UHFFFAOYSA-N |
| SMILES | CCN(C[Si](C)(C)C)C[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Aethyl-bis-trimethylsilylmethyl-amin |
| 4-Aethyl-2,2,6,6-tetramethyl-4-aza-2,6-disila-heptan |
| 4-ethyl-2,2,6,6-tetramethyl-4-aza-2,6-disila-heptane |