Silane,ethenyltris(2-propen-1-yloxy)- structure
|
Common Name | Silane,ethenyltris(2-propen-1-yloxy)- | ||
|---|---|---|---|---|
| CAS Number | 17988-31-7 | Molecular Weight | 226.34400 | |
| Density | 0.922g/cm3 | Boiling Point | 221.5ºC at 760mmHg | |
| Molecular Formula | C11H18O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 86.4ºC | |
| Name | ethenyl-tris(prop-2-enoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.922g/cm3 |
|---|---|
| Boiling Point | 221.5ºC at 760mmHg |
| Molecular Formula | C11H18O3Si |
| Molecular Weight | 226.34400 |
| Flash Point | 86.4ºC |
| Exact Mass | 226.10300 |
| PSA | 27.69000 |
| LogP | 2.25830 |
| Vapour Pressure | 0.158mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | QGBISTZTHSLEDF-UHFFFAOYSA-N |
| SMILES | C=CCO[Si](C=C)(OCC=C)OCC=C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tris-allyloxy-vinyl-silane |