N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine
N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine structure
|
Common Name | N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 179556-82-2 | Molecular Weight | 325.44800 | |
| Density | 1.11g/cm3 | Boiling Point | 430ºC at 760mmHg | |
| Molecular Formula | C20H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 430ºC at 760mmHg |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.44800 |
| Flash Point | 213.9ºC |
| Exact Mass | 325.21500 |
| PSA | 28.60000 |
| LogP | 3.51900 |
| Vapour Pressure | 1.34E-07mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | VNSBZWKWQFCKGO-UHFFFAOYSA-N |
| SMILES | CCOc1cccnc1N(C)C1CCN(Cc2ccccc2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(1-benzylpipe... CAS#:179556-82-2 |
| Literature: Genin; Poel; Yagi; Biles; Althaus; Keiser; Kopta; Friis; Reusser; Adams; Olmsted; Voorman; Thomas; Romero Journal of Medicinal Chemistry, 1996 , vol. 39, # 26 p. 5267 - 5275 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: Molecular weight of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is 325.44800. |
| Q: What is the InChIKey of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: InChIKey of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is VNSBZWKWQFCKGO-UHFFFAOYSA-N. |
| Q: What is the LogP of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: LogP of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is 3.51900. |
| Q: What is the CAS number of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: CAS number of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is 179556-82-2. |
| Q: What is the SMILES notation of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: SMILES notation of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is CCOc1cccnc1N(C)C1CCN(Cc2ccccc2)CC1. |
| Q: What is the English name of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: The English name of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine. |
| Q: What is the Chinese name of 179556-82-2? |
| A: Chinese name of 179556-82-2 is 179556-82-2. |
| Q: What is the boiling point of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: Boiling point of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is 430ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: Polar surface area (PSA) of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is 28.60000. |
| Q: What is the molecular formula of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine? |
| A: Molecular formula of N-(1-benzylpiperidin-4-yl)-3-ethoxy-N-methylpyridin-2-amine is C20H27N3O. |