Ketotifen-d3 fumarate structure
|
Common Name | Ketotifen-d3 fumarate | ||
|---|---|---|---|---|
| CAS Number | 1795138-23-6 | Molecular Weight | 428.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20D3NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ketotifen-d3 fumarateKetotifen-d3 (HC 20511-d3) fumarate is the deuterium labeled Ketotifen fumarate. Ketotifen (HC 20511) fumarate is a second-generation noncompetitive H1-antihistamine and mast cell stabilizer, which is used to prevent asthma attacks[1][2]. |
| Name | Ketotifen-d3 fumarate |
|---|
| Description | Ketotifen-d3 (HC 20511-d3) fumarate is the deuterium labeled Ketotifen fumarate. Ketotifen (HC 20511) fumarate is a second-generation noncompetitive H1-antihistamine and mast cell stabilizer, which is used to prevent asthma attacks[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C23H20D3NO5S |
|---|---|
| Molecular Weight | 428.52 |
| InChIKey | YNQQEYBLVYAWNX-PCUGBSCUSA-N |
| SMILES | CN1CCC(=C2c3ccccc3CC(=O)c3sccc32)CC1.O=C(O)C=CC(=O)O |