[1-[(2-aminophenyl)methyl]-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methanol structure
|
Common Name | [1-[(2-aminophenyl)methyl]-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 178980-12-6 | Molecular Weight | 422.37100 | |
| Density | 1.36g/cm3 | Boiling Point | 600.5ºC at 760 mmHg | |
| Molecular Formula | C20H21Cl2N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.9ºC | |
| Name | [1-[(2-aminophenyl)methyl]-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methanol |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 600.5ºC at 760 mmHg |
| Molecular Formula | C20H21Cl2N3OS |
| Molecular Weight | 422.37100 |
| Flash Point | 316.9ºC |
| Exact Mass | 421.07800 |
| PSA | 89.37000 |
| LogP | 6.16850 |
| Vapour Pressure | 2.88E-15mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | SHKPIQFDZLQIHU-UHFFFAOYSA-N |
| SMILES | CC(C)c1nc(CO)n(Cc2ccccc2N)c1Sc1cc(Cl)cc(Cl)c1 |
|
~49%
[1-[(2-aminophe... CAS#:178980-12-6 |
| Literature: Shionogi and Co., Ltd. Patent: US5910506 A1, 1999 ; |