2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]ethyl carbamate structure
|
Common Name | 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]ethyl carbamate | ||
|---|---|---|---|---|
| CAS Number | 178979-51-6 | Molecular Weight | 418.33800 | |
| Density | 1.38g/cm3 | Boiling Point | 602.3ºC at 760 mmHg | |
| Molecular Formula | C17H21Cl2N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318ºC | |
| Name | 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]ethyl carbamate |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 602.3ºC at 760 mmHg |
| Molecular Formula | C17H21Cl2N3O3S |
| Molecular Weight | 418.33800 |
| Flash Point | 318ºC |
| Exact Mass | 417.06800 |
| PSA | 105.66000 |
| LogP | 5.12720 |
| Vapour Pressure | 1.85E-14mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | CDONJXSARYPBSF-UHFFFAOYSA-N |
| SMILES | CC(C)c1nc(COCCOC(N)=O)n(C)c1Sc1cc(Cl)cc(Cl)c1 |
|
~90%
2-[[5-(3,5-dich... CAS#:178979-51-6 |
| Literature: Shionogi and Co., Ltd. Patent: US5910506 A1, 1999 ; |