1-Naphthylamine-4,6,8-trisulfonic acid structure
|
Common Name | 1-Naphthylamine-4,6,8-trisulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 17894-99-4 | Molecular Weight | 383.37500 | |
| Density | 1.974 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO9S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-aminonaphthalene-1,3,5-trisulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.974 g/cm3 |
|---|---|
| Molecular Formula | C10H9NO9S3 |
| Molecular Weight | 383.37500 |
| Exact Mass | 382.94400 |
| PSA | 214.27000 |
| LogP | 3.98570 |
| Index of Refraction | 1.748 |
| InChIKey | RQVVDWMOCSOAJS-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12 |
| HS Code | 2921499090 |
|---|
|
~%
1-Naphthylamine... CAS#:17894-99-4 |
| Literature: Helvetica Chimica Acta, , vol. 35, p. 2139,2144 |
|
~%
1-Naphthylamine... CAS#:17894-99-4 |
| Literature: Helvetica Chimica Acta, , vol. 35, p. 2139,2144 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Naphthylamin-(1)-trisulfonsaeure-(4.6.8) |
| 8-amino-1,3,5-naphthalenetrisulfonic acid |
| 8-amino-naphthalene-1,3,5-trisulfonic acid |
| 1-Naphthylamine-4,6,8-trisulfonic acid |
| 8-Amino-naphthalin-1,3,5-trisulfonsaeure |
| 1-Aminonaphthalene-4,6,8-trisulfonic acid |
| EINECS 241-837-3 |
| MFCD00035848 |