(2-Amino-5-chlorophenyl)-cyclohexylmethanone structure
|
Common Name | (2-Amino-5-chlorophenyl)-cyclohexylmethanone | ||
|---|---|---|---|---|
| CAS Number | 1789-30-6 | Molecular Weight | 237.72500 | |
| Density | 1.202g/cm3 | Boiling Point | 390.9ºC at 760mmHg | |
| Molecular Formula | C13H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.2ºC | |
| Name | (2-Amino-5-chlorophenyl)-cyclohexylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 390.9ºC at 760mmHg |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.72500 |
| Flash Point | 190.2ºC |
| Exact Mass | 237.09200 |
| PSA | 43.09000 |
| LogP | 4.26640 |
| Vapour Pressure | 2.56E-06mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | XCKJMNZTSNFNHE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1C(=O)C1CCCCC1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-5-chlorphenylcyclohexylketon |
| 2-amino-5-chlorophenyl cyclohexyl ketone |
| Cyclohexyl-<5-chlor-2-amino-phenyl>-keton |