3-(3-Fluorophenyl)-2-methylquinazolin-4(3H)-one structure
|
Common Name | 3-(3-Fluorophenyl)-2-methylquinazolin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 1789-04-4 | Molecular Weight | 254.25900 | |
| Density | 1.25g/cm3 | Boiling Point | 409.1ºC at 760 mmHg | |
| Molecular Formula | C15H11FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | 3-(3-fluorophenyl)-2-methylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 409.1ºC at 760 mmHg |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.25900 |
| Flash Point | 201.2ºC |
| Exact Mass | 254.08600 |
| PSA | 34.89000 |
| LogP | 2.83320 |
| Vapour Pressure | 6.68E-07mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | KVLRRULUXONAGA-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1cccc(F)c1 |
| HS Code | 2933990090 |
|---|
|
~45%
3-(3-Fluorophen... CAS#:1789-04-4 |
| Literature: Hilmy, Khalid Mohamed Hassan; Mogensen, Joergen; Pedersen, Erik B. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1987 , vol. 41, p. 467 - 468 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| b 214 |
| chi 71 |