Phosphoric acid 2-piperidinoethyldipropyl ester structure
|
Common Name | Phosphoric acid 2-piperidinoethyldipropyl ester | ||
|---|---|---|---|---|
| CAS Number | 17875-14-8 | Molecular Weight | 293.33900 | |
| Density | 1.057g/cm3 | Boiling Point | 366.1ºC at 760 mmHg | |
| Molecular Formula | C13H28NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | 2-piperidin-1-ylethyl dipropyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760 mmHg |
| Molecular Formula | C13H28NO4P |
| Molecular Weight | 293.33900 |
| Flash Point | 175.2ºC |
| Exact Mass | 293.17600 |
| PSA | 57.81000 |
| LogP | 3.38810 |
| Vapour Pressure | 1.5E-05mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | FAPNRBQIKHKRJG-UHFFFAOYSA-N |
| SMILES | CCCOP(=O)(OCCC)OCCN1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ds 48 |