3-hydroxy-2-(hydroxymethyl)-2-methyl-2'-phenylpropionohydrazide structure
|
Common Name | 3-hydroxy-2-(hydroxymethyl)-2-methyl-2'-phenylpropionohydrazide | ||
|---|---|---|---|---|
| CAS Number | 17872-56-9 | Molecular Weight | 224.25600 | |
| Density | 1.274g/cm3 | Boiling Point | 397.8ºC at 760mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4ºC | |
| Name | 3-hydroxy-2-(hydroxymethyl)-2-methyl-N'-phenylpropanehydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 397.8ºC at 760mmHg |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Flash Point | 194.4ºC |
| Exact Mass | 224.11600 |
| PSA | 85.08000 |
| LogP | 1.03390 |
| Vapour Pressure | 4.85E-07mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | QXVQVTBWOPOSTG-UHFFFAOYSA-N |
| SMILES | CC(CO)(CO)C(=O)NNc1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| einecs 241-825-8 |