Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate structure
|
Common Name | Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1784119-83-0 | Molecular Weight | 239.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9NO4S |
|---|---|
| Molecular Weight | 239.25 |
| InChIKey | PRGLYIIBPLLZLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(C#N)c2c1OCCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate? |
| A: CAS number of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate is 1784119-83-0. |
| Q: What is the molecular weight of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate? |
| A: Molecular weight of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate is 239.25. |
| Q: What is the Chinese name of 1784119-83-0? |
| A: Chinese name of 1784119-83-0 is 1784119-83-0. |
| Q: What is the InChIKey of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate? |
| A: InChIKey of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate is PRGLYIIBPLLZLF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate? |
| A: Molecular formula of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate is C10H9NO4S. |
| Q: What is the English name of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate? |
| A: The English name of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate is Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate. |
| Q: What is the SMILES notation of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate? |
| A: SMILES notation of Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate is CCOC(=O)c1sc(C#N)c2c1OCCO2. |