butyl-methyl-diphenylstannane
butyl-methyl-diphenylstannane structure
|
Common Name | butyl-methyl-diphenylstannane | ||
|---|---|---|---|---|
| CAS Number | 17841-99-5 | Molecular Weight | 345.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | butyl-methyl-diphenylstannane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H22Sn |
|---|---|
| Molecular Weight | 345.1 |
| Exact Mass | 346.074353 |
| LogP | 4.84950 |
| InChIKey | LABPKTGTOFXJEW-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
butyl-methyl-di... CAS#:17841-99-5 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.4.5, page 89 - 91 |
|
~%
butyl-methyl-di... CAS#:17841-99-5 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.4.5, page 89 - 91 |
|
~%
butyl-methyl-di... CAS#:17841-99-5 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.4.5, page 89 - 91 |
|
~%
butyl-methyl-di... CAS#:17841-99-5 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.4.5, page 89 - 91 |
|
~%
butyl-methyl-di... CAS#:17841-99-5 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.4.5, page 89 - 91 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| n.Butyl-methyl-diphenylzinn |
| Stannane,butylmethyldiphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of butyl-methyl-diphenylstannane? |
| A: CAS number of butyl-methyl-diphenylstannane is 17841-99-5. |
| Q: What English synonyms does butyl-methyl-diphenylstannane have? |
| A: English synonyms of butyl-methyl-diphenylstannane: n.Butyl-methyl-diphenylzinn, Stannane,butylmethyldiphenyl. |
| Q: What is the LogP of butyl-methyl-diphenylstannane? |
| A: LogP of butyl-methyl-diphenylstannane is 4.84950. |
| Q: What is the InChIKey of butyl-methyl-diphenylstannane? |
| A: InChIKey of butyl-methyl-diphenylstannane is LABPKTGTOFXJEW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 17841-99-5? |
| A: Chinese name of 17841-99-5 is 17841-99-5. |
| Q: What is the molecular formula of butyl-methyl-diphenylstannane? |
| A: Molecular formula of butyl-methyl-diphenylstannane is C17H22Sn. |
| Q: What is the molecular weight of butyl-methyl-diphenylstannane? |
| A: Molecular weight of butyl-methyl-diphenylstannane is 345.1. |
| Q: What is the English name of butyl-methyl-diphenylstannane? |
| A: The English name of butyl-methyl-diphenylstannane is butyl-methyl-diphenylstannane. |
| Q: What is the SMILES notation of butyl-methyl-diphenylstannane? |
| A: SMILES notation of butyl-methyl-diphenylstannane is CCCC[Sn](C)(C1=CC=CC=C1)C2=CC=CC=C2. |