1,1,1,3,3,3-hexapropyl-Disiloxane
1,1,1,3,3,3-hexapropyl-Disiloxane structure
|
Common Name | 1,1,1,3,3,3-hexapropyl-Disiloxane | ||
|---|---|---|---|---|
| CAS Number | 17841-51-9 | Molecular Weight | 330.69600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H42OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,3,3,3-hexapropyl-Disiloxane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H42OSi2 |
|---|---|
| Molecular Weight | 330.69600 |
| Exact Mass | 330.27700 |
| PSA | 9.23000 |
| LogP | 7.35400 |
| Vapour Pressure | 0.000731mmHg at 25°C |
| InChIKey | KHQZLUVCZCAMFU-UHFFFAOYSA-N |
| SMILES | CCC[Si](CCC)(CCC)O[Si](CCC)(CCC)CCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934999090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:995-25-5
CAS#:17841-46-2![1-[amino(dipropyl)silyl]propane structure](https://image.chemsrc.com/caspic/336/17616-66-9.png)
CAS#:17616-66-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: Molecular weight of 1,1,1,3,3,3-hexapropyl-Disiloxane is 330.69600. |
| Q: What is the SMILES notation of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: SMILES notation of 1,1,1,3,3,3-hexapropyl-Disiloxane is CCC[Si](CCC)(CCC)O[Si](CCC)(CCC)CCC. |
| Q: What are the downstream products of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: Related downstream products(CAS) of 1,1,1,3,3,3-hexapropyl-Disiloxane: 995-25-5;17841-46-2;17616-66-9. |
| Q: What is the English name of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: The English name of 1,1,1,3,3,3-hexapropyl-Disiloxane is 1,1,1,3,3,3-hexapropyl-Disiloxane. |
| Q: What is the InChIKey of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: InChIKey of 1,1,1,3,3,3-hexapropyl-Disiloxane is KHQZLUVCZCAMFU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: CAS number of 1,1,1,3,3,3-hexapropyl-Disiloxane is 17841-51-9. |
| Q: What is the polar surface area (PSA) of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: Polar surface area (PSA) of 1,1,1,3,3,3-hexapropyl-Disiloxane is 9.23000. |
| Q: What is the molecular formula of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: Molecular formula of 1,1,1,3,3,3-hexapropyl-Disiloxane is C18H42OSi2. |
| Q: What is the LogP of 1,1,1,3,3,3-hexapropyl-Disiloxane? |
| A: LogP of 1,1,1,3,3,3-hexapropyl-Disiloxane is 7.35400. |
| Q: What is the Chinese name of 17841-51-9? |
| A: Chinese name of 17841-51-9 is 17841-51-9. |