7-tert-butyl-3,3-dimethyl-5-nitro-2H-1-benzofuran structure
|
Common Name | 7-tert-butyl-3,3-dimethyl-5-nitro-2H-1-benzofuran | ||
|---|---|---|---|---|
| CAS Number | 178322-42-4 | Molecular Weight | 249.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-tert-butyl-3,3-dimethyl-5-nitro-2H-1-benzofuran |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO3 |
|---|---|
| Molecular Weight | 249.30600 |
| Exact Mass | 249.13600 |
| PSA | 55.05000 |
| LogP | 4.08550 |
| InChIKey | RHCXNHRXYSCHHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])cc2c1OCC2(C)C |
|
~41%
7-tert-butyl-3,... CAS#:178322-42-4 |
| Literature: The Procter and Gamble Company Patent: US5684041 A1, 1997 ; |
| 7-tert-butyl-2,3-dihydro-3,3-dimethyl-5-nitrobenzofuran |