Bayogenin-3-O-β-D-Glucuronopyranoside-28-O-β-D-glucopyranosyl ester structure
|
Common Name | Bayogenin-3-O-β-D-Glucuronopyranoside-28-O-β-D-glucopyranosyl ester | ||
|---|---|---|---|---|
| CAS Number | 178248-96-9 | Molecular Weight | 826.96 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 933.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H66O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.1±27.8 °C | |
Use of Bayogenin-3-O-β-D-Glucuronopyranoside-28-O-β-D-glucopyranosyl esterDescription Natural product derived from plant source.} |
| Name | Bayogenin-3-O-β-D-Glucuronopyranoside-28-O-β-D-glucopyranosyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 933.0±65.0 °C at 760 mmHg |
| Molecular Formula | C42H66O16 |
| Molecular Weight | 826.96 |
| Flash Point | 274.1±27.8 °C |
| Exact Mass | 826.435059 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | YQDXYGOKFNYKCJ-FIXUWSFMSA-N |
| SMILES | CC1(C)CCC2(C(=O)OC3OC(CO)C(O)C(O)C3O)CCC3(C)C(=CCC4C5(C)CC(O)C(OC6OC(C(=O)O)C(O)C(O)C6O)C(C)(CO)C5CCC43C)C2C1 |
| WGK Germany | 3 |
|---|
| MFCD24849343 |