1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]
Modify Date: 2026-08-01 13:01:02
![1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] Structure](https://www.chemsrc.com/extcaspic/274/1782467-96-2.png)
1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] structure
|
Common Name | 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] | ||
|---|---|---|---|---|
| CAS Number | 1782467-96-2 | Molecular Weight | 247.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H25N3 |
|---|---|
| Molecular Weight | 247.38 |
| InChIKey | JROOEODQWQSFFP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CC(C)(N)N2CCN(C)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1782467-96-2? |
| A: Chinese name of 1782467-96-2 is 1782467-96-2. |
| Q: What is the SMILES notation of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]? |
| A: SMILES notation of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] is Cc1ccc(CC(C)(N)N2CCN(C)CC2)cc1. |
| Q: What is the molecular weight of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]? |
| A: Molecular weight of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] is 247.38. |
| Q: What is the InChIKey of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]? |
| A: InChIKey of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] is JROOEODQWQSFFP-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]? |
| A: The English name of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] is 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]. |
| Q: What is the CAS number of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]? |
| A: CAS number of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] is 1782467-96-2. |
| Q: What is the molecular formula of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl]? |
| A: Molecular formula of 1-Piperazinemethanamine, I+/-,4-dimethyl-I+/--[(4-methylphenyl)methyl] is C15H25N3. |