1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid
1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid structure
|
Common Name | 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 17794-42-2 | Molecular Weight | 295.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13N3O6 |
|---|---|
| Molecular Weight | 295.24800 |
| Exact Mass | 295.08000 |
| PSA | 132.18000 |
| LogP | 3.05790 |
| InChIKey | YJWRTHKSJFBLGH-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCCCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
1-(2,4-dinitrop... CAS#:17794-42-2 |
| Literature: Chicharro, Roberto; De Castro, Sonia; Reino, Jose L.; Aran, Vicente J. European Journal of Organic Chemistry, 2003 , # 12 p. 2314 - 2326 |
|
~70%
1-(2,4-dinitrop... CAS#:17794-42-2 |
| Literature: Adegoke, E. A.; Alo, Babajide I.; Ogunsulire, F. O. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 1169 - 1172 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 17794-42-2? |
| A: Chinese name of 17794-42-2 is 17794-42-2. |
| Q: What is the polar surface area (PSA) of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: Polar surface area (PSA) of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is 132.18000. |
| Q: What is the CAS number of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: CAS number of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is 17794-42-2. |
| Q: What is the English name of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: The English name of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid. |
| Q: What is the LogP of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: LogP of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is 3.05790. |
| Q: What is the SMILES notation of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: SMILES notation of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is O=C(O)C1CCCCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the molecular formula of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: Molecular formula of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is C12H13N3O6. |
| Q: What is the molecular weight of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: Molecular weight of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is 295.24800. |
| Q: What is the InChIKey of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid? |
| A: InChIKey of 1-(2,4-dinitrophenyl)piperidine-2-carboxylic acid is YJWRTHKSJFBLGH-UHFFFAOYSA-N. |