3-(1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL)PROPANOIC ACID structure
|
Common Name | 3-(1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL)PROPANOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 17781-08-7 | Molecular Weight | 252.22700 | |
| Density | 1.56g/cm3 | Boiling Point | 557.7ºC at 760mmHg | |
| Molecular Formula | C10H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 557.7ºC at 760mmHg |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.22700 |
| Flash Point | 291.1ºC |
| Exact Mass | 252.08600 |
| PSA | 99.12000 |
| Vapour Pressure | 2.84E-13mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | ZYUPLDFSBVJNIH-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCC(=O)O)n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methoxycarbonylethyltheophylline |
| 3-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7h-purin-7-yl)propanoic acid |
| 3-(1,3-dimethyl-2,6-dioxo-1,3,7-trihydropurin-7-yl)propanoic acid |
| 3-(1,3-Dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-purin-7-yl)-propionic acid |
| 3-(1,3-Dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-purin-7-yl)-propionsaeure |