7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol structure
|
Common Name | 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 177722-97-3 | Molecular Weight | 546.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F13IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12F13IO |
|---|---|
| Molecular Weight | 546.10700 |
| Exact Mass | 545.97300 |
| PSA | 20.23000 |
| LogP | 6.08150 |
| InChIKey | MNBTZWGXQAMLCE-UHFFFAOYSA-N |
| SMILES | OCCCCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Dodecanol,7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodo |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: The English name of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol. |
| Q: What is the polar surface area (PSA) of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: Polar surface area (PSA) of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is 20.23000. |
| Q: What is the molecular formula of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: Molecular formula of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is C12H12F13IO. |
| Q: What is the SMILES notation of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: SMILES notation of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is OCCCCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the InChIKey of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: InChIKey of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is MNBTZWGXQAMLCE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: Molecular weight of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is 546.10700. |
| Q: What is the LogP of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: LogP of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is 6.08150. |
| Q: What English synonyms does 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol have? |
| A: English synonyms of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol: 1-Dodecanol,7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodo. |
| Q: What is the CAS number of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol? |
| A: CAS number of 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododecan-1-ol is 177722-97-3. |
| Q: What is the Chinese name of 177722-97-3? |
| A: Chinese name of 177722-97-3 is 177722-97-3. |