dimethyl 1,3-adamantanediacetate structure
|
Common Name | dimethyl 1,3-adamantanediacetate | ||
|---|---|---|---|---|
| CAS Number | 17768-29-5 | Molecular Weight | 280.359 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 340.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C16H24O4 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 160.2±18.8 °C | |
| Name | methyl 2-[3-(2-methoxy-2-oxoethyl)-1-adamantyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.1±15.0 °C at 760 mmHg |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.359 |
| Flash Point | 160.2±18.8 °C |
| Exact Mass | 280.167450 |
| PSA | 52.60000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | SGBCQIADOMIJEZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC12CC3CC(C1)CC(CC(=O)OC)(C3)C2 |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Adamantan-diessigsaeure-(1,3)-dimethylester |
| Dimethyl 2,2'-(1s,3s)-tricyclo[3.3.1.1]decane-1,3-diyldiacetate |
| 1,3-Adamantan-diessigsaeure-dimethylester |
| Tricyclo[3.3.1.1]decane-1,3-diacetic acid, dimethyl ester |
| Dimethyl 1,3-adamantanediacetate |