Nepicastat hydrochloride monohydrate
Modify Date: 2024-02-05 22:51:44
Nepicastat hydrochloride monohydrate structure
|
Common Name | Nepicastat hydrochloride monohydrate | ||
|---|---|---|---|---|
| CAS Number | 177645-08-8 | Molecular Weight | 349.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18ClF2N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nepicastat hydrochloride monohydrateNepicastat hydrochloride monohydrate is an inhibitor of dopamine beta-hydroxylase, an enzyme that catalyzes the conversion of dopamine to norepinephrine. |
| Name | Nepicastat hydrochloride monohydrate |
|---|
| Description | Nepicastat hydrochloride monohydrate is an inhibitor of dopamine beta-hydroxylase, an enzyme that catalyzes the conversion of dopamine to norepinephrine. |
|---|
| Molecular Formula | C14H18ClF2N3OS |
|---|---|
| Molecular Weight | 349.82 |
| InChIKey | AILBEJJAAWNNIR-XRIOVQLTSA-N |
| SMILES | Cl.NCc1c[nH]c(=S)n1C1CCc2c(F)cc(F)cc2C1.O |