4-amino-4-(2-carboxyethyl)heptanedioic acid
Modify Date: 2025-09-18 17:46:10
4-amino-4-(2-carboxyethyl)heptanedioic acid structure
|
Common Name | 4-amino-4-(2-carboxyethyl)heptanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 176738-98-0 | Molecular Weight | 247.24500 | |
| Density | 1.364g/cm3 | Boiling Point | 522.4ºC at 760mmHg | |
| Molecular Formula | C10H17NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.7ºC | |
| Name | 4-amino-4-(2-carboxyethyl)heptanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.364g/cm3 |
|---|---|
| Boiling Point | 522.4ºC at 760mmHg |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.24500 |
| Flash Point | 269.7ºC |
| Exact Mass | 247.10600 |
| PSA | 137.92000 |
| LogP | 0.97860 |
| Vapour Pressure | 2.58E-12mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | UOPIUZMVWLTGPP-UHFFFAOYSA-N |
| SMILES | NC(CCC(=O)O)(CCC(=O)O)CCC(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Aminomethanetrispropionic acid |