N-[3,3-Bis(4-aminophenyl)propyl]acetamide structure
|
Common Name | N-[3,3-Bis(4-aminophenyl)propyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 17665-87-1 | Molecular Weight | 283.36800 | |
| Density | 1.162g/cm3 | Boiling Point | 572ºC at 760 mmHg | |
| Molecular Formula | C17H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.8ºC | |
| Name | N-[1,3-bis(4-aminophenyl)propyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 572ºC at 760 mmHg |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.36800 |
| Flash Point | 299.8ºC |
| Exact Mass | 283.16800 |
| PSA | 84.63000 |
| LogP | 4.66370 |
| Vapour Pressure | 4.28E-13mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | RHNCZCKFXXVROF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CCc1ccc(N)cc1)c1ccc(N)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| TK 174 acetate |