H-D-Val-Obzl.TosOH structure
|
Common Name | H-D-Val-Obzl.TosOH | ||
|---|---|---|---|---|
| CAS Number | 17662-84-9 | Molecular Weight | 379.470 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25NO5S | Melting Point | 162ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-D-Val-Obzl.TosOHH-D-Val-Obzl.TosOH is a valine derivative[1]. |
| Name | benzyl (2R)-2-amino-3-methylbutanoate,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-D-Val-Obzl.TosOH is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Melting Point | 162ºC |
|---|---|
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.470 |
| Exact Mass | 379.145355 |
| PSA | 115.07000 |
| LogP | 4.73590 |
| Index of Refraction | 4 ° (C=3.2, MeOH) |
| InChIKey | QWUQVUDPBXFOKF-RFVHGSKJSA-N |
| SMILES | CC(C)C(N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| Storage condition | Store at RT. |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| ammonium tosylate salt of (2R)-valine benzyl ester |
| H-D-Val-OBzlTosOH |
| D-Valine, phenylmethyl ester, 4-methylbenzenesulfonate (1:1) |
| R-val-OBz p-toluenesulfonate |
| Benzyl D-valinate 4-methylbenzenesulfonate (1:1) |
| (R)-Benzyl 2-amino-3-methylbutanoate 4-methylbenzenesulfonate |
| D-Valine Benzyl Ester p-Toluenesulfonate |
| p-toluenesulphonate salt of D-valine benzyl ester |
| ammonium tosylate salt of D-valine-benzyl ester |
| D-valine benzylester,tosylate salt |
| H-D-Val-Obzl.TosOH |