Silane(1,4-phenylenedimethylidene)tetrakis[trimethyl
Modify Date: 2025-08-31 10:03:20
Silane(1,4-phenylenedimethylidene)tetrakis[trimethyl structure
|
Common Name | Silane(1,4-phenylenedimethylidene)tetrakis[trimethyl | ||
|---|---|---|---|---|
| CAS Number | 17557-10-7 | Molecular Weight | 394.88900 | |
| Density | 0.849g/cm3 | Boiling Point | 375.6ºC at 760mmHg | |
| Molecular Formula | C20H42Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.7ºC | |
| Name | [[4-[bis(trimethylsilyl)methyl]phenyl]-trimethylsilylmethyl]-trimethylsilane |
|---|
| Density | 0.849g/cm3 |
|---|---|
| Boiling Point | 375.6ºC at 760mmHg |
| Molecular Formula | C20H42Si4 |
| Molecular Weight | 394.88900 |
| Flash Point | 149.7ºC |
| Exact Mass | 394.23600 |
| LogP | 7.55440 |
| Vapour Pressure | 1.66E-05mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | WDBXRQMXEOERGV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(c1ccc(C([Si](C)(C)C)[Si](C)(C)C)cc1)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |