RO 46-8443
Modify Date: 2025-08-25 08:35:20
RO 46-8443 structure
|
Common Name | RO 46-8443 | ||
|---|---|---|---|---|
| CAS Number | 175556-12-4 | Molecular Weight | 609.690 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 683.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C31H35N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.0±34.3 °C | |
Use of RO 46-8443Ro 46-8443 is the first non-peptide endothelin ETB receptor selective antagonist. Ro 46-8443 displays an at least 100-fold selectivity for ETB (IC50: 34-69 nM) over ETA receptors (IC50: 6800 nM)[1][2]. |
| Name | Ro 46-8443 |
|---|---|
| Synonym | More Synonyms |
| Description | Ro 46-8443 is the first non-peptide endothelin ETB receptor selective antagonist. Ro 46-8443 displays an at least 100-fold selectivity for ETB (IC50: 34-69 nM) over ETA receptors (IC50: 6800 nM)[1][2]. |
|---|---|
| Related Catalog | |
| Target |
ETB:34-69 nM (IC50) ETA:6800 nM (IC50) |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 683.1±65.0 °C at 760 mmHg |
| Molecular Formula | C31H35N3O8S |
| Molecular Weight | 609.690 |
| Flash Point | 367.0±34.3 °C |
| Exact Mass | 609.214478 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | DRIHNVYRUGBDHI-JOCHJYFZSA-N |
| SMILES | COc1ccc(-c2nc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c(Oc3ccccc3OC)c(OCC(O)CO)n2)cc1 |
| Storage condition | 2-8°C |
| Ro 46-8443 |
| MFCD00946586 |
| Benzenesulfonamide, N-[6-[(2R)-2,3-dihydroxypropoxy]-5-(2-methoxyphenoxy)-2-(4-methoxyphenyl)-4-pyrimidinyl]-4-(1,1-dimethylethyl)- |
| N-{6-[(2R)-2,3-Dihydroxypropoxy]-5-(2-methoxyphenoxy)-2-(4-methoxyphenyl)-4-pyrimidinyl}-4-(2-methyl-2-propanyl)benzenesulfonamide |