N,N'-DI(2-BROMOPHENYL)UREA
Modify Date: 2025-08-24 21:12:32
N,N'-DI(2-BROMOPHENYL)UREA structure
|
Common Name | N,N'-DI(2-BROMOPHENYL)UREA | ||
|---|---|---|---|---|
| CAS Number | 175278-34-9 | Molecular Weight | 370.03900 | |
| Density | 1.829g/cm3 | Boiling Point | 344.4ºC at 760 mmHg | |
| Molecular Formula | C13H10Br2N2O | Melting Point | 235ºC | |
| MSDS | N/A | Flash Point | 162.1ºC | |
| Name | 1,3-bis(2-bromophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.829g/cm3 |
|---|---|
| Boiling Point | 344.4ºC at 760 mmHg |
| Melting Point | 235ºC |
| Molecular Formula | C13H10Br2N2O |
| Molecular Weight | 370.03900 |
| Flash Point | 162.1ºC |
| Exact Mass | 367.91600 |
| PSA | 41.13000 |
| LogP | 5.00160 |
| Vapour Pressure | 6.59E-05mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | KGIPPUCGBSFACI-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1Br)Nc1ccccc1Br |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-di(2-bromophenyl)urea |
| Urea,N,N'-bis(2-bromophenyl) |