1-(4-ISOBUTYLPHENYL)-3-(3-NITROPHENYL)PROP-2-EN-1-ONE structure
|
Common Name | 1-(4-ISOBUTYLPHENYL)-3-(3-NITROPHENYL)PROP-2-EN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 175205-30-8 | Molecular Weight | 309.35900 | |
| Density | 1.154g/cm3 | Boiling Point | 466.3ºC at 760mmHg | |
| Molecular Formula | C19H19NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 210ºC | |
| Name | 1-[4-(2-methylpropyl)phenyl]-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 466.3ºC at 760mmHg |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.35900 |
| Flash Point | 210ºC |
| Exact Mass | 309.13600 |
| PSA | 62.89000 |
| LogP | 5.21260 |
| Vapour Pressure | 7.18E-09mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | FCKXLIVUBCYENE-DHZHZOJOSA-N |
| SMILES | CC(C)Cc1ccc(C(=O)C=Cc2cccc([N+](=O)[O-])c2)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Propen-1-one,1-[4-(2-methylpropyl)phenyl]-3-(3-nitrophenyl) |
| 1-(4-isobutylphenyl)-3-(3-nitrophenyl)prop-2-en-1-one |