methyl 4,7-dibromo-3-methoxynaphthalene-2-carboxylate structure
|
Common Name | methyl 4,7-dibromo-3-methoxynaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175204-91-8 | Molecular Weight | 374.02500 | |
| Density | 1.717g/cm3 | Boiling Point | 438.7ºC at 760 mmHg | |
| Molecular Formula | C13H10Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.1ºC | |
| Name | methyl 4,7-dibromo-3-methoxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.717g/cm3 |
|---|---|
| Boiling Point | 438.7ºC at 760 mmHg |
| Molecular Formula | C13H10Br2O3 |
| Molecular Weight | 374.02500 |
| Flash Point | 219.1ºC |
| Exact Mass | 371.90000 |
| PSA | 35.53000 |
| LogP | 4.16000 |
| Vapour Pressure | 6.78E-08mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | HOLPDXPBBBQZLM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc(Br)ccc2c(Br)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS1530O13 |
| methyl 4,7-dibromo-3-methoxy-naphthalene-2-carboxylate |
| methyl 4,7-dibromo-3-methoxy-2-naphthoate |