Methyl 2-Chloro-4-(1-pyrrolidinyl)benzoate structure
|
Common Name | Methyl 2-Chloro-4-(1-pyrrolidinyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 175153-38-5 | Molecular Weight | 239.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-chloro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14ClNO2 |
|---|---|
| Molecular Weight | 239.69800 |
| Exact Mass | 239.07100 |
| PSA | 29.54000 |
| LogP | 2.79180 |
| InChIKey | CSBLQYDWEPLAOP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2CCCC2)cc1Cl |
| HS Code | 2933990090 |
|---|
|
~85%
Methyl 2-Chloro... CAS#:175153-38-5 |
| Literature: Tsukamoto, Issei; Koshio, Hiroyuki; Akamatsu, Seijiro; Kuramochi, Takahiro; Saitoh, Chikashi; Yatsu, Takeyuki; Yanai-Inamura, Hiroko; Kitada, Chika; Yamamoto, Eisaku; Sakamoto, Shuichi; Tsukamoto, Shin-ichi Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 21 p. 9524 - 9535 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-chloro-4-(1-pyrrolidinyl)benzenecarboxylate |
| methyl 2-chloro-4-(pyrrolidin-1-yl)benzoate |
| methyl 2-chloro-4-pyrrolidinylbenzoate |
| 2-chloro-4-(pyrrolidin-1-yl)benzoic acid methyl ester |