(7S,9S)9-ACETYL-7,8,9,10-TETRAHYDRO-6,7,9,11-TETRAHYDROXY-5,12-NAPHTACENEDIONE structure
|
Common Name | (7S,9S)9-ACETYL-7,8,9,10-TETRAHYDRO-6,7,9,11-TETRAHYDROXY-5,12-NAPHTACENEDIONE | ||
|---|---|---|---|---|
| CAS Number | 175136-37-5 | Molecular Weight | 412.07300 | |
| Density | 1.671g/cm3 | Boiling Point | 491.1ºC at 760mmHg | |
| Molecular Formula | C16H12Br2O3 | Melting Point | 110ºC | |
| MSDS | N/A | Flash Point | 250.8ºC | |
| Name | (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(4-bromophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.671g/cm3 |
|---|---|
| Boiling Point | 491.1ºC at 760mmHg |
| Melting Point | 110ºC |
| Molecular Formula | C16H12Br2O3 |
| Molecular Weight | 412.07300 |
| Flash Point | 250.8ºC |
| Exact Mass | 409.91500 |
| PSA | 35.53000 |
| LogP | 4.60390 |
| Vapour Pressure | 8.62E-10mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | UFUGCEORIIOXQG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Br)cc1)c1cc2c(cc1Br)OCCCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (8-Bromo-3,4-Dihydro-2H-1,5-Benzodioxepin-7-Yl)(4-Bromophenyl)Methanone |
| HMS1522G04 |