1-(2,4-DIMETHYLPHENYL)ETHANOL structure
|
Common Name | 1-(2,4-DIMETHYLPHENYL)ETHANOL | ||
|---|---|---|---|---|
| CAS Number | 175135-54-3 | Molecular Weight | 257.07300 | |
| Density | 1.5g/cm3 | Boiling Point | 382.4ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | 1-(2,5-dichloro-4-nitrophenyl)pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 382.4ºC at 760 mmHg |
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.07300 |
| Flash Point | 185ºC |
| Exact Mass | 255.98100 |
| PSA | 50.75000 |
| LogP | 4.21550 |
| Vapour Pressure | 1.05E-05mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | AOWBNTITDQLWTN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(-n2cccc2)cc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2,5-dichloro-4-nitrophenyl)-1H-pyrrole |