IC-9564
Modify Date: 2025-05-02 08:22:42
IC-9564 structure
|
Common Name | IC-9564 | ||
|---|---|---|---|---|
| CAS Number | 174847-98-4 | Molecular Weight | 755.12100 | |
| Density | 1.073g/cm3 | Boiling Point | 874.4ºC at 760mmHg | |
| Molecular Formula | C46H78N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 482.6ºC | |
Use of IC-9564IC-9564 (AIDS033640) is a betulinic acid derivative and potent HIV entry inhibitor that blocks HIV-1 envelope-mediated membrane fusion with IC90 of 0.22 uM for NL4-3 strain. |
| Name | (3R,4S)-4-[8-[[(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbonyl]amino]octanoylamino]-3-hydroxy-6-methylheptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 874.4ºC at 760mmHg |
| Molecular Formula | C46H78N2O6 |
| Molecular Weight | 755.12100 |
| Flash Point | 482.6ºC |
| Exact Mass | 754.58600 |
| PSA | 142.94000 |
| LogP | 10.50880 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | SPZFCKVVHXRLAI-ZGEYYWTRSA-N |
| SMILES | C=C(C)C1CCC2(C(=O)NCCCCCCCC(=O)NC(CC(C)C)C(O)CC(=O)O)CCC3(C)C(CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C12 |
| IC-9564 |