N,N-bis(2-nitrophenyl)methanediamine
Modify Date: 2025-09-16 18:47:30
N,N-bis(2-nitrophenyl)methanediamine structure
|
Common Name | N,N-bis(2-nitrophenyl)methanediamine | ||
|---|---|---|---|---|
| CAS Number | 17465-20-2 | Molecular Weight | 288.25900 | |
| Density | 1.467g/cm3 | Boiling Point | 547.7ºC at 760 mmHg | |
| Molecular Formula | C13H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285ºC | |
| Name | N,N'-Bis-(2-nitro-phenyl)-aethylendiamin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 547.7ºC at 760 mmHg |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.25900 |
| Flash Point | 285ºC |
| Exact Mass | 288.08600 |
| PSA | 115.70000 |
| LogP | 4.17690 |
| Vapour Pressure | 4.77E-12mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | DUXFILQCDRVMQG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1NCNc1ccccc1[N+](=O)[O-] |
| HS Code | 2921590090 |
|---|
|
~86%
N,N-bis(2-nitro... CAS#:17465-20-2 |
| Literature: Floc'H, Yves Le; Morvan, Jean-Marcel; Brault, Auguste Bulletin de la Societe Chimique de France, 1980 , vol. 2, # 3-4 p. 157 - 162 |
|
~%
N,N-bis(2-nitro... CAS#:17465-20-2 |
| Literature: Pulvermacher Chemische Berichte, 1892 , vol. 25, p. 2764 Chemische Berichte, 1893 , vol. 26, p. 955 |
|
~%
N,N-bis(2-nitro... CAS#:17465-20-2 |
| Literature: Smith; Welch Journal of the Chemical Society, 1934 , p. 1136,1139 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
CAS#:612-28-2
CAS#:17474-44-1
CAS#:15805-10-4![1-nitro-3-[(3-nitrophenyl)methyl]benzene structure](https://image.chemsrc.com/caspic/042/4164-43-6.png)
CAS#:4164-43-6| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bis-(2-nitro-anilino)-methan |
| N,N'-Bis-(2-nitro-phenyl)-methylendiamin |
| bis-(2-nitro-benzylidene)-hydrazine |
| methylene-bis-(o-nitroaniline) |
| (bis-2-nitroanilino)methane |
| Bis-(2-nitro-benzal)-hydrazin |
| N,N'-bis(2-nitrophenyl)-1,2-ethanediamine |
| Bis-(2-nitro-benzyliden)-hydrazin |
| N,N'-bis-(2-nitro-phenyl)-methylenediamine |
| 1,2-Bis(2-nitrobenzylidene)hydrazine |
| N,N'-bis(2-nitrophenyl)-ethylenediamine |
| N.N'-Methylen-bis-(2-nitro-anilin) |
| N,N'-BIS-(2-NITRO-PHENYL)-METHANEDIAMINE |
| N,N'-bis-(2-nitro-benzylidene)-hydrazine |
| 2-nitrobenzaldehyde N-[-(2-nitrophenyl)methylidene]hydrazone |