5-(4-chlorophenyl)-1-methyl-1h-imidazole-2-thiol
Modify Date: 2025-09-23 14:11:40
5-(4-chlorophenyl)-1-methyl-1h-imidazole-2-thiol structure
|
Common Name | 5-(4-chlorophenyl)-1-methyl-1h-imidazole-2-thiol | ||
|---|---|---|---|---|
| CAS Number | 17452-31-2 | Molecular Weight | 224.71000 | |
| Density | 1.39g/cm3 | Boiling Point | 330ºC at 760mmHg | |
| Molecular Formula | C10H9ClN2S | Melting Point | 244ºC | |
| MSDS | N/A | Flash Point | 153.4ºC | |
| Name | 4-(4-chlorophenyl)-3-methyl-1H-imidazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 330ºC at 760mmHg |
| Melting Point | 244ºC |
| Molecular Formula | C10H9ClN2S |
| Molecular Weight | 224.71000 |
| Flash Point | 153.4ºC |
| Exact Mass | 224.01700 |
| PSA | 56.62000 |
| LogP | 3.02920 |
| Vapour Pressure | 0.000171mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | RGYNOPLNIDBIGT-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccc(Cl)cc2)c[nH]c1=S |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(p-Chlor-phenyl)-3-methyl-2-mercapto-imidazol |
| 5-(4-chloro-phenyl)-1-methyl-1,3-dihydro-imidazole-2-thione |
| 5-(chlorophenyl)-1-methyl-1H-imidazole-2-thiol |
| 5-(4-chlorophenyl)-1-methylimidazole-2-thiol |
| 5-(4-chlorophenyl)-1-methyl-1H-imidazole-2-thiol |