6H-Purine-6-thione,1,9-dihydro-9-(phenylmethyl)-
Modify Date: 2025-08-24 22:02:52
6H-Purine-6-thione,1,9-dihydro-9-(phenylmethyl)- structure
|
Common Name | 6H-Purine-6-thione,1,9-dihydro-9-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 17447-84-6 | Molecular Weight | 242.30000 | |
| Density | 1.39 g/cm3 | Boiling Point | 490.8ºC at 760 mmHg | |
| Molecular Formula | C12H10N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 9-benzyl-3H-purine-6-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39 g/cm3 |
|---|---|
| Boiling Point | 490.8ºC at 760 mmHg |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.30000 |
| Flash Point | 250.6ºC |
| Exact Mass | 242.06300 |
| PSA | 78.59000 |
| LogP | 2.53720 |
| Vapour Pressure | 8.86E-10mmHg at 25°C |
| Index of Refraction | 1.747 |
| InChIKey | XLBDEMIFDOANPN-UHFFFAOYSA-N |
| SMILES | S=c1nc[nH]c2c1ncn2Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-benzyl-3,9-dihydro-6H-purine-6-thione |
| 9-benzyl-1,9-dihydro-purine-6-thione |
| 9-Benzyl-9H-purin-6(1H)-thion |
| 9-Benzyl-9H-Purine-6(1H)-thione |
| 9-Benzyl-6-mercaptopurin |