9H-Purin-2-amine,9-methyl-6-(trifluoromethyl)- structure
|
Common Name | 9H-Purin-2-amine,9-methyl-6-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1744-14-5 | Molecular Weight | 217.15100 | |
| Density | 1.76g/cm3 | Boiling Point | 401.6ºC at 760mmHg | |
| Molecular Formula | C7H6F3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 9-methyl-6-(trifluoromethyl)purin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760mmHg |
| Molecular Formula | C7H6F3N5 |
| Molecular Weight | 217.15100 |
| Flash Point | 196.7ºC |
| Exact Mass | 217.05800 |
| PSA | 69.62000 |
| LogP | 1.54550 |
| Vapour Pressure | 1.17E-06mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | ULPNHMMJISXCBK-UHFFFAOYSA-N |
| SMILES | Cn1cnc2c(C(F)(F)F)nc(N)nc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| f2124-0875 |