AKOS B013913 structure
|
Common Name | AKOS B013913 | ||
|---|---|---|---|---|
| CAS Number | 17432-00-7 | Molecular Weight | 248.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-2-[3-(trifluoromethyl)phenoxy]-propanoic acid |
|---|
| Molecular Formula | C11H11F3O3 |
|---|---|
| Molecular Weight | 248.19800 |
| Exact Mass | 248.06600 |
| PSA | 46.53000 |
| LogP | 2.94740 |
| InChIKey | DRROMOGOGUVQOW-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1cccc(C(F)(F)F)c1)C(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
AKOS B013913 CAS#:17432-00-7 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 20 p. 7567 - 7571 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |