4-(p-Bromophenyl)-4,5-dimethyl-2-cyclohexen-1-one structure
|
Common Name | 4-(p-Bromophenyl)-4,5-dimethyl-2-cyclohexen-1-one | ||
|---|---|---|---|---|
| CAS Number | 17429-37-7 | Molecular Weight | 279.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-bromophenyl)-4,5-dimethylcyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15BrO |
|---|---|
| Molecular Weight | 279.17200 |
| Exact Mass | 278.03100 |
| PSA | 17.07000 |
| LogP | 3.87190 |
| InChIKey | CKMKVUDREHULBH-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C=CC1(C)c1ccc(Br)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-(4-Bromophenyl)-4,5-dimethyl-2-cyclohexen-1-one |
| 4-(p-Bromophenyl)-4,5-dimethyl-2-cyclohexen-1-one |
| 2-Cyclohexen-1-one,4-(p-bromophenyl)-4,5-dimethyl |