[6-[tert-butyl(dimethyl)silyl]oxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone structure
|
Common Name | [6-[tert-butyl(dimethyl)silyl]oxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 174264-47-2 | Molecular Weight | 587.84400 | |
| Density | 1.15g/cm3 | Boiling Point | 706.195ºC at 760 mmHg | |
| Molecular Formula | C34H41NO4SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 380.893ºC | |
| Name | [6-[tert-butyl(dimethyl)silyl]oxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 706.195ºC at 760 mmHg |
| Molecular Formula | C34H41NO4SSi |
| Molecular Weight | 587.84400 |
| Flash Point | 380.893ºC |
| Exact Mass | 587.25300 |
| PSA | 87.24000 |
| LogP | 8.69150 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | LVZAJJMYYKOTDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(C(=O)c3ccc(OCCN4CCCCC4)cc3)c(-c3ccc(O)cc3)sc2c1 |
|
~%
[6-[tert-butyl(... CAS#:174264-47-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 40, # 2 p. 146 - 167 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 6-tert-Butyldimethylsilyl-4'-hydroxy Raloxifene |